4(Z),7(Z),10(Z),13(Z)-Hexadecatetraenoic Acid methyl ester structure
|
Common Name | 4(Z),7(Z),10(Z),13(Z)-Hexadecatetraenoic Acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 873108-81-7 | Molecular Weight | 262.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4(Z),7(Z),10(Z),13(Z)-Hexadecatetraenoic Acid methyl ester4(Z),7(Z),10(Z),13(Z)-Hexadecatetraenoic acid methyl ester is the methyl ester version of an unusual polyunsaturated fatty acid (PUFA) generated during the synthesis of docosahexaenoic acid-d5 |
| Name | methyl hexadeca-4,7,10,13-tetraenoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26O2 |
|---|---|
| Molecular Weight | 262.38700 |
| Exact Mass | 262.19300 |
| PSA | 26.30000 |
| LogP | 4.74470 |
| InChIKey | GRTBKGOZZPTTEE-GJDCDIHCSA-N |
| SMILES | CCC=CCC=CCC=CCC=CCCC(=O)OC |
| 4,7,10,13-Hexadecatetraenoic acid,methyl ester,(4Z,7Z,10Z,13Z) |