Benzenesulfonamide,N,N'-[1,3-phenylenebis(methylene)]bis[4-methyl- (9CI) structure
|
Common Name | Benzenesulfonamide,N,N'-[1,3-phenylenebis(methylene)]bis[4-methyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 87338-18-9 | Molecular Weight | 444.56700 | |
| Density | 1.29g/cm3 | Boiling Point | 639.6ºC at 760mmHg | |
| Molecular Formula | C22H24N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.6ºC | |
| Name | 4-methyl-N-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 639.6ºC at 760mmHg |
| Molecular Formula | C22H24N2O4S2 |
| Molecular Weight | 444.56700 |
| Flash Point | 340.6ºC |
| Exact Mass | 444.11800 |
| PSA | 109.10000 |
| LogP | 6.20380 |
| Index of Refraction | 1.61 |
| InChIKey | KUDFZOBPEKPYHN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cccc(CNS(=O)(=O)c3ccc(C)cc3)c2)cc1 |
|
~72%
Benzenesulfonam... CAS#:87338-18-9 |
| Literature: Vriesema, Bindert K.; Buter, Jan; Kellogg, Richard M. Journal of Organic Chemistry, 1984 , vol. 49, # 1 p. 110 - 113 |
|
~%
Benzenesulfonam... CAS#:87338-18-9 |
| Literature: Ruggli; Leupin; Dahn Helvetica Chimica Acta, 1947 , vol. 30, p. 1845,1850 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N'-m-xylylene-bis-toluene-4-sulfonamide |
| N,N'-m-Xylylen-bis-toluol-4-sulfonamid |