2-methyl-3-(naphthalen-2-ylamino)propanoic acid structure
|
Common Name | 2-methyl-3-(naphthalen-2-ylamino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 873554-99-5 | Molecular Weight | 229.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-(naphthalen-2-ylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15NO2 |
|---|---|
| Molecular Weight | 229.27400 |
| Exact Mass | 229.11000 |
| PSA | 49.33000 |
| LogP | 3.04540 |
| InChIKey | MXYQTDGZIVJFKA-UHFFFAOYSA-N |
| SMILES | CC(CNc1ccc2ccccc2c1)C(=O)O |
|
~50%
2-methyl-3-(nap... CAS#:873554-99-5 |
| Literature: Pijper, Dirk; Van Delden, Richard A.; Meetsma, Auke; Feringa, Ben L. Journal of the American Chemical Society, 2005 , vol. 127, # 50 p. 17612 - 17613 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-3-(naphthalen-6-ylamino)propanoic acid |
| Propanoic acid,2-methyl-3-(2-naphthalenylamino) |