1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione
![1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione Structure](https://image.chemsrc.com/caspic/174/87393-69-9.png)
1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione structure
|
Common Name | 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 87393-69-9 | Molecular Weight | 354.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H18O6 |
|---|---|
| Molecular Weight | 354.35300 |
| Exact Mass | 354.11000 |
| PSA | 111.90000 |
| LogP | 2.00330 |
| InChIKey | ZUFHNYGPBPJGGX-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CCO)Cc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,8-dihydroxy-3... CAS#:87393-69-9 |
| Literature: Krohn, Karsten; Sarstedt, Burkhard Angewandte Chemie, 1983 , vol. 95, # 11 p. 897 - 898 |
![3-[2-(2-bromoethyl)-3-oxobutyl]-1,8-dihydroxyanthracene-9,10-dione structure](https://image.chemsrc.com/caspic/288/87393-66-6.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-Anthracenedione,1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: Molecular weight of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is 354.35300. |
| Q: What is the CAS number of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: CAS number of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is 87393-69-9. |
| Q: What English synonyms does 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione have? |
| A: English synonyms of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione: 9,10-Anthracenedione,1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]. |
| Q: What is the InChIKey of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: InChIKey of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is ZUFHNYGPBPJGGX-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: Polar surface area (PSA) of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is 111.90000. |
| Q: What is the LogP of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: LogP of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is 2.00330. |
| Q: What is the molecular formula of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: Molecular formula of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is C20H18O6. |
| Q: What are the upstream materials of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: Related upstream materials(CAS) of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione: 87393-66-6. |
| Q: What is the SMILES notation of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: SMILES notation of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is CC(=O)C(CCO)Cc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O. |
| Q: What is the English name of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione? |
| A: The English name of 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione is 1,8-dihydroxy-3-[2-(2-hydroxyethyl)-3-oxobutyl]anthracene-9,10-dione. |