1-bromo-3-(toluene-4-sulfonyl)-acetone
1-bromo-3-(toluene-4-sulfonyl)-acetone structure
|
Common Name | 1-bromo-3-(toluene-4-sulfonyl)-acetone | ||
|---|---|---|---|---|
| CAS Number | 874009-26-4 | Molecular Weight | 291.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Bromo-3-(toluene-4-sulfonyl)-acetone (CAS号：874009-26-4), molecular formula C10H11BrO3S, molecular weight 291.16200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bromo-3-(toluene-4-sulfonyl)-acetone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11BrO3S |
|---|---|
| Molecular Weight | 291.16200 |
| Exact Mass | 289.96100 |
| PSA | 59.59000 |
| LogP | 2.81350 |
| InChIKey | RPOCRPNTKMHXCC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)CBr)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:57122-47-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Tolyl-(3-brom-acetonyl)-sulfon |
| 1-Brom-3-(toluol-4-sulfonyl)-aceton |
| α'-Brom-α-p-tolylsulfon-aceton |
| 3-Brom-1-p-tolylsulfon-aceton |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: InChIKey of 1-bromo-3-(toluene-4-sulfonyl)-acetone is RPOCRPNTKMHXCC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 874009-26-4? |
| A: Chinese name of 874009-26-4 is 874009-26-4. |
| Q: What is the SMILES notation of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: SMILES notation of 1-bromo-3-(toluene-4-sulfonyl)-acetone is Cc1ccc(S(=O)(=O)CC(=O)CBr)cc1. |
| Q: What is the polar surface area (PSA) of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: Polar surface area (PSA) of 1-bromo-3-(toluene-4-sulfonyl)-acetone is 59.59000. |
| Q: What is the molecular weight of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: Molecular weight of 1-bromo-3-(toluene-4-sulfonyl)-acetone is 291.16200. |
| Q: What is the CAS number of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: CAS number of 1-bromo-3-(toluene-4-sulfonyl)-acetone is 874009-26-4. |
| Q: What is the LogP of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: LogP of 1-bromo-3-(toluene-4-sulfonyl)-acetone is 2.81350. |
| Q: What is the molecular formula of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: Molecular formula of 1-bromo-3-(toluene-4-sulfonyl)-acetone is C10H11BrO3S. |
| Q: What is the English name of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: The English name of 1-bromo-3-(toluene-4-sulfonyl)-acetone is 1-bromo-3-(toluene-4-sulfonyl)-acetone. |
| Q: What are the downstream products of 1-bromo-3-(toluene-4-sulfonyl)-acetone? |
| A: Related downstream products(CAS) of 1-bromo-3-(toluene-4-sulfonyl)-acetone: 57122-47-1. |