Tephrocarpin
Modify Date: 2025-09-01 18:43:40
Tephrocarpin structure
|
Common Name | Tephrocarpin | ||
|---|---|---|---|---|
| CAS Number | 87402-98-0 | Molecular Weight | 330.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tephrocarpin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14O7 |
|---|---|
| Molecular Weight | 330.29 |
| InChIKey | MWQPAELXDZZOEN-DLBZAZTESA-N |
| SMILES | COc1c(O)ccc2c1OCC1(O)c3cc4c(cc3OC21)OCO4 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Tephrocarpin? |
| A: Molecular formula of Tephrocarpin is C17H14O7. |
| Q: What is the molecular weight of Tephrocarpin? |
| A: Molecular weight of Tephrocarpin is 330.29. |
| Q: What is the CAS number of Tephrocarpin? |
| A: CAS number of Tephrocarpin is 87402-98-0. |
| Q: What is the Chinese name of 87402-98-0? |
| A: Chinese name of 87402-98-0 is 87402-98-0. |
| Q: What is the SMILES notation of Tephrocarpin? |
| A: SMILES notation of Tephrocarpin is COc1c(O)ccc2c1OCC1(O)c3cc4c(cc3OC21)OCO4. |
| Q: What is the English name of Tephrocarpin? |
| A: The English name of Tephrocarpin is Tephrocarpin. |
| Q: What is the InChIKey of Tephrocarpin? |
| A: InChIKey of Tephrocarpin is MWQPAELXDZZOEN-DLBZAZTESA-N. |