4-(4-ethynylphenyl)aniline structure
|
Common Name | 4-(4-ethynylphenyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 874362-76-2 | Molecular Weight | 193.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-ethynylphenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11N |
|---|---|
| Molecular Weight | 193.24400 |
| Exact Mass | 193.08900 |
| PSA | 26.02000 |
| LogP | 3.49830 |
| InChIKey | JYNBLIVLAVFGEH-UHFFFAOYSA-N |
| SMILES | C#Cc1ccc(-c2ccc(N)cc2)cc1 |
|
~96%
4-(4-ethynylphe... CAS#:874362-76-2 |
| Literature: Xie, Jian; Seto, Christopher T. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 1 p. 458 - 473 |
|
~%
4-(4-ethynylphe... CAS#:874362-76-2 |
| Literature: Xie, Jian; Seto, Christopher T. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 1 p. 458 - 473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4'-Ethynyl-[1,1'-biphenyl]-4-amine |
| [1,1'-Biphenyl]-4-amine,4'-ethynyl |