2-(2-methoxy-ethoxy)-5-nitro-pyridine structure
|
Common Name | 2-(2-methoxy-ethoxy)-5-nitro-pyridine | ||
|---|---|---|---|---|
| CAS Number | 874492-44-1 | Molecular Weight | 198.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-methoxyethoxy)-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10N2O4 |
|---|---|
| Molecular Weight | 198.17600 |
| Exact Mass | 198.06400 |
| PSA | 77.17000 |
| LogP | 1.53820 |
| InChIKey | VRVHHUJTYWVESQ-UHFFFAOYSA-N |
| SMILES | COCCOc1ccc([N+](=O)[O-])cn1 |
|
~79%
2-(2-methoxy-et... CAS#:874492-44-1 |
| Literature: ASTEX THERAPEUTICS LIMITED Patent: WO2006/77414 A1, 2006 ; Location in patent: Page/Page column 139 ; WO 2006/077414 A1 |
|
~%
2-(2-methoxy-et... CAS#:874492-44-1 |
| Literature: ASTRAZENECA AB Patent: WO2007/53094 A1, 2007 ; Location in patent: Page/Page column 67 ; WO 2007/053094 A1 |
|
~%
2-(2-methoxy-et... CAS#:874492-44-1 |
| Literature: Friedman et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 1204 |
|
~%
2-(2-methoxy-et... CAS#:874492-44-1 |
| Literature: GRÜNENTHAL GMBH; FRANK, Robert; BAHRENBERG, Gregor; CHRISTOPH, Thomas; LESCH, Bernhard Patent: WO2013/13815 A1, 2013 ; WO 2013/013815 A1 |
| 2-(2-methoxy-ethoxy)-5-nitro-pyridine |
| Pyridine,2-(2-methoxyethoxy)-5-nitro |
| 2-(2-Methoxy-aethoxy)-5-nitro-pyridin |