1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole
Modify Date: 2026-06-28 18:18:42
![1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole Structure](https://www.chemsrc.com/extcaspic/079/874591-46-5.png)
1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole structure
|
Common Name | 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 874591-46-5 | Molecular Weight | 276.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12N4O |
|---|---|
| Molecular Weight | 276.29 |
| InChIKey | LBCQCCOZABFRBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)CN3C=NC4=CC=CC=C43 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 6, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole? |
| A: SMILES notation of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole is C1=CC=C(C=C1)C2=NN=C(O2)CN3C=NC4=CC=CC=C43. |
| Q: What is the CAS number of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole? |
| A: CAS number of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole is 874591-46-5. |
| Q: What is the Chinese name of 874591-46-5? |
| A: Chinese name of 874591-46-5 is 874591-46-5. |
| Q: What is the InChIKey of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole? |
| A: InChIKey of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole is LBCQCCOZABFRBB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole? |
| A: Molecular weight of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole is 276.29. |
| Q: What is the English name of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole? |
| A: The English name of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole is 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole. |
| Q: What is the molecular formula of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole? |
| A: Molecular formula of 1-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1H-benzimidazole is C16H12N4O. |