2-Bromo-4,5-difluorobenzenesulfonyl chloride structure
|
Common Name | 2-Bromo-4,5-difluorobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 874784-11-9 | Molecular Weight | 291.498 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 307.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H2BrClF2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.8±27.9 °C | |
| Name | 2-Bromo-4,5-difluorobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.5±42.0 °C at 760 mmHg |
| Molecular Formula | C6H2BrClF2O2S |
| Molecular Weight | 291.498 |
| Flash Point | 139.8±27.9 °C |
| Exact Mass | 289.861542 |
| PSA | 42.52000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | RZIOWUSICQPJJF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(F)c(F)cc1Br |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Bromo-4,5-difluorobenzenesulfonyl chloride |
| Benzenesulfonyl chloride, 2-bromo-4,5-difluoro- |