2,5-diphenyl-1,4-dihydropyrazine structure
|
Common Name | 2,5-diphenyl-1,4-dihydropyrazine | ||
|---|---|---|---|---|
| CAS Number | 87498-10-0 | Molecular Weight | 234.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-diphenyl-1,4-dihydropyrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N2 |
|---|---|
| Molecular Weight | 234.29600 |
| Exact Mass | 234.11600 |
| PSA | 31.58000 |
| LogP | 4.23900 |
| InChIKey | GYBYPABGMJHWPL-UHFFFAOYSA-N |
| SMILES | C1=C(c2ccccc2)NC=C(c2ccccc2)N1 |
|
~%
2,5-diphenyl-1,... CAS#:87498-10-0 |
| Literature: Higgins, Stanley D.; Thomas, C. Barry Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 7 p. 1483 - 1488 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-diphenyl-1,4-dihydro-pyrazine |
| 1,4-dihydro-2,5-diphenylpyrazine |
| 2,5-Diphenyl-pyrazin |