Open Ring Aztreonam structure
|
Common Name | Open Ring Aztreonam | ||
|---|---|---|---|---|
| CAS Number | 87500-74-1 | Molecular Weight | 453.44800 | |
| Density | 1.76g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H19N5O9S2 | Melting Point | >182°C (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sq 26,992 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Melting Point | >182°C (dec.) |
| Molecular Formula | C13H19N5O9S2 |
| Molecular Weight | 453.44800 |
| Exact Mass | 453.06200 |
| PSA | 271.44000 |
| LogP | 0.90160 |
| Appearance of Characters | White to Off-White,Solid |
| Index of Refraction | 1.689 |
| InChIKey | IBLNMEMSULYOOK-VEHQQRBSSA-N |
| SMILES | CC(NS(=O)(=O)O)C(NC(=O)C(=NOC(C)(C)C(=O)O)c1csc(N)n1)C(=O)O |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2934100000 |
| (2S,3S)-2-{[(2Z)-2-(2-Amino-1,3-thiazol-4-yl)-2-{[(2-carboxy-2-pr opanyl)oxy]imino}acetyl]amino}-3-(sulfoamino)butanoic acid |
| Open Ring Aztreonam |