2-(4-chlorophenyl)-3-methylcyclopent-2-en-1-one structure
|
Common Name | 2-(4-chlorophenyl)-3-methylcyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 87506-06-7 | Molecular Weight | 206.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)-3-methylcyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11ClO |
|---|---|
| Molecular Weight | 206.66800 |
| Exact Mass | 206.05000 |
| PSA | 17.07000 |
| LogP | 3.47640 |
| InChIKey | OIHCCUFBBJSVFK-UHFFFAOYSA-N |
| SMILES | CC1=C(c2ccc(Cl)cc2)C(=O)CC1 |
|
~87%
2-(4-chlorophen... CAS#:87506-06-7 |
| Literature: Itami, Kenichiro; Mitsudo, Koichi; Fujita, Kazuyoshi; Ohashi, Youichi; Yoshida, Jun-Ichi Journal of the American Chemical Society, 2004 , vol. 126, # 35 p. 11058 - 11066 |
|
~%
2-(4-chlorophen... CAS#:87506-06-7 |
| Literature: Nakamura, Eiichi; Shimada, Jun-ichi; Kuwajima, Isao Journal of the Chemical Society, Chemical Communications, 1983 , # 9 p. 498 - 499 |
| 2-Cyclopenten-1-one,2-(4-chlorophenyl)-3-methyl |
| 2-(4-chlorophenyl)-3-methyl-2-cyclopenten-1-one |