N-[4-(2-chloroacetyl)phenyl]furan-2-carboxamide structure
|
Common Name | N-[4-(2-chloroacetyl)phenyl]furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 875160-52-4 | Molecular Weight | 263.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(2-chloroacetyl)phenyl]furan-2-carboxamide |
|---|
| Molecular Formula | C13H10ClNO3 |
|---|---|
| Molecular Weight | 263.67 |
| InChIKey | RZLNJWMGGPVYAG-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=CC=C(C=C2)C(=O)CCl |
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|