1-methyl-9-nitrophenanthrene structure
|
Common Name | 1-methyl-9-nitrophenanthrene | ||
|---|---|---|---|---|
| CAS Number | 87517-97-3 | Molecular Weight | 237.25300 | |
| Density | 1.277g/cm3 | Boiling Point | 425.8ºC at 760 mmHg | |
| Molecular Formula | C15H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.9ºC | |
| Name | 1-methyl-9-nitrophenanthrene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 425.8ºC at 760 mmHg |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25300 |
| Flash Point | 209.9ºC |
| Exact Mass | 237.07900 |
| PSA | 45.82000 |
| LogP | 4.73280 |
| Index of Refraction | 1.719 |
| InChIKey | FDXNCIJOOLPXJW-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c1cc([N+](=O)[O-])c1ccccc12 |
|
~%
1-methyl-9-nitr... CAS#:87517-97-3 |
| Literature: Hasselstrom Journal of the American Chemical Society, 1941 , vol. 63, p. 2527 |
|
~%
1-methyl-9-nitr... CAS#:87517-97-3 |
| Literature: Hasselstrom Journal of the American Chemical Society, 1941 , vol. 63, p. 2527 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phenanthrene,1-methyl-9-nitro |
| 1-methyl-9-nitro-phenanthrene |