methyl 5-(phenylmethoxymethoxy)hex-2-enoate structure
|
Common Name | methyl 5-(phenylmethoxymethoxy)hex-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 87518-81-8 | Molecular Weight | 264.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-(phenylmethoxymethoxy)hex-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20O4 |
|---|---|
| Molecular Weight | 264.31700 |
| Exact Mass | 264.13600 |
| PSA | 44.76000 |
| LogP | 2.68510 |
| InChIKey | KZZBGXDTWRWKID-UHFFFAOYSA-N |
| SMILES | COC(=O)C=CCC(C)OCOCc1ccccc1 |
|
~%
methyl 5-(pheny... CAS#:87518-81-8 |
| Literature: Thaisrivongs,S.; Seebach,D. Journal of the American Chemical Society, 1983 , vol. 105, p. 7407 |
|
~%
methyl 5-(pheny... CAS#:87518-81-8 |
| Literature: Thaisrivongs,S.; Seebach,D. Journal of the American Chemical Society, 1983 , vol. 105, p. 7407 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| methyl (E)-5-((benzyloxy)methoxy)-2-hexenoate |
| 2-Hexenoic acid,5-[(phenylmethoxy)methoxy]-,methyl ester,(E) |