ditert-butyl(2-methylpropyl)phosphane
ditert-butyl(2-methylpropyl)phosphane structure
|
Common Name | ditert-butyl(2-methylpropyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 87522-71-2 | Molecular Weight | 202.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H27P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: ditert-butyl(2-methylpropyl)phosphane, Chinese name: 二叔丁基（2-甲基丙基）磷烷, CAS number: 87522-71-2, molecular formula: C12H27P, molecular weight: 202.31700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ditert-butyl(2-methylpropyl)phosphane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H27P |
|---|---|
| Molecular Weight | 202.31700 |
| Exact Mass | 202.18500 |
| PSA | 13.59000 |
| LogP | 4.72130 |
| InChIKey | SGLINYPFAYPYIM-UHFFFAOYSA-N |
| SMILES | CC(C)CP(C(C)(C)C)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ditert-butyl(2-... CAS#:87522-71-2 |
| Literature: Bottomley, Andrew R. H.; Crocker, Christopher; Shaw, Bernard L. Journal of Organometallic Chemistry, 1983 , vol. 250, # 1 p. 617 - 626 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphine,bis(1,1-dimethylethyl)(2-methylpropyl) |
| di-t-butyl(isobutyl)phosphine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ditert-butyl(2-methylpropyl)phosphane? |
| A: SMILES notation of ditert-butyl(2-methylpropyl)phosphane is CC(C)CP(C(C)(C)C)C(C)(C)C. |
| Q: What is the InChIKey of ditert-butyl(2-methylpropyl)phosphane? |
| A: InChIKey of ditert-butyl(2-methylpropyl)phosphane is SGLINYPFAYPYIM-UHFFFAOYSA-N. |
| Q: What is the LogP of ditert-butyl(2-methylpropyl)phosphane? |
| A: LogP of ditert-butyl(2-methylpropyl)phosphane is 4.72130. |
| Q: What English synonyms does ditert-butyl(2-methylpropyl)phosphane have? |
| A: English synonyms of ditert-butyl(2-methylpropyl)phosphane: Phosphine,bis(1,1-dimethylethyl)(2-methylpropyl), di-t-butyl(isobutyl)phosphine. |
| Q: What is the molecular formula of ditert-butyl(2-methylpropyl)phosphane? |
| A: Molecular formula of ditert-butyl(2-methylpropyl)phosphane is C12H27P. |
| Q: What is the English name of ditert-butyl(2-methylpropyl)phosphane? |
| A: The English name of ditert-butyl(2-methylpropyl)phosphane is ditert-butyl(2-methylpropyl)phosphane. |
| Q: What is the polar surface area (PSA) of ditert-butyl(2-methylpropyl)phosphane? |
| A: Polar surface area (PSA) of ditert-butyl(2-methylpropyl)phosphane is 13.59000. |
| Q: What are the upstream materials of ditert-butyl(2-methylpropyl)phosphane? |
| A: Related upstream materials(CAS) of ditert-butyl(2-methylpropyl)phosphane: 78-77-3;13716-10-4. |
| Q: What is the Chinese name of 87522-71-2? |
| A: Chinese name of 87522-71-2 is 87522-71-2. |
| Q: What is the CAS number of ditert-butyl(2-methylpropyl)phosphane? |
| A: CAS number of ditert-butyl(2-methylpropyl)phosphane is 87522-71-2. |