1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate structure
|
Common Name | 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate | ||
|---|---|---|---|---|
| CAS Number | 875451-01-7 | Molecular Weight | 441.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H27N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H27N3O4S |
|---|---|
| Molecular Weight | 441.5 |
| InChIKey | CVQRBWBNJSVNLZ-UHFFFAOYSA-N |
| SMILES | Cc1noc(C)c1CSc1ccccc1C(=O)OC(C)C(=O)NC1(C#N)CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate? |
| A: The English name of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate is 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate. |
| Q: What is the CAS number of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate? |
| A: CAS number of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate is 875451-01-7. |
| Q: What is the InChIKey of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate? |
| A: InChIKey of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate is CVQRBWBNJSVNLZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate? |
| A: SMILES notation of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate is Cc1noc(C)c1CSc1ccccc1C(=O)OC(C)C(=O)NC1(C#N)CCCCC1. |
| Q: What is the molecular formula of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate? |
| A: Molecular formula of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate is C23H27N3O4S. |
| Q: What is the molecular weight of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate? |
| A: Molecular weight of 1-[(1-Cyanocyclohexyl)carbamoyl]ethyl 2-{[(3,5-dimethyl-1,2-oxazol-4-YL)methyl]sulfanyl}benzoate is 441.5. |
| Q: What is the Chinese name of 875451-01-7? |
| A: Chinese name of 875451-01-7 is 875451-01-7. |