3-chloro-N-(4-methoxyphenyl)-2-methyl-2-phenylsulfanylpropanamide structure
|
Common Name | 3-chloro-N-(4-methoxyphenyl)-2-methyl-2-phenylsulfanylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 87568-26-1 | Molecular Weight | 335.84800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-N-(4-methoxyphenyl)-2-methyl-2-phenylsulfanylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18ClNO2S |
|---|---|
| Molecular Weight | 335.84800 |
| Exact Mass | 335.07500 |
| PSA | 63.63000 |
| LogP | 4.49650 |
| InChIKey | VKDIUBJQHCSIFP-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)C(C)(CCl)Sc2ccccc2)cc1 |
|
~%
3-chloro-N-(4-m... CAS#:87568-26-1 |
| Literature: Ihara; Haga; Yonekura; et al. Journal of the American Chemical Society, 1983 , vol. 105, # 25 p. 7345 - 7352 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Propanamide,3-chloro-N-(4-methoxyphenyl)-2-methyl-2-(phenylthio) |