Ethyl 3-bromo-4-butoxybenzoate
Modify Date: 2025-09-11 04:24:26
Ethyl 3-bromo-4-butoxybenzoate structure
|
Common Name | Ethyl 3-bromo-4-butoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 875846-74-5 | Molecular Weight | 301.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-bromo-4-butoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17BrO3 |
|---|---|
| Molecular Weight | 301.17600 |
| Exact Mass | 300.03600 |
| PSA | 35.53000 |
| LogP | 3.80470 |
| InChIKey | HUVNVOHPRDFRGA-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(C(=O)OCC)cc1Br |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-bromo-4-butoxybenzoic acid ethyl ester |
| ethyl 3-bromanyl-4-butoxy-benzoate |