N-[1-(1-hydroxypyridin-2-ylidene)ethylimino]-3-methyl-piperidine-1-carbothioamide structure
|
Common Name | N-[1-(1-hydroxypyridin-2-ylidene)ethylimino]-3-methyl-piperidine-1-carbothioamide | ||
|---|---|---|---|---|
| CAS Number | 87587-06-2 | Molecular Weight | 292.40000 | |
| Density | 1.23g/cm3 | Boiling Point | 401.9ºC at 760 mmHg | |
| Molecular Formula | C14H20N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
| Name | N-[(1Z)-1-(1-hydroxypyridin-2-ylidene)ethyl]imino-3-methylpiperidine-1-carbothioamide |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 401.9ºC at 760 mmHg |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.40000 |
| Flash Point | 196.9ºC |
| Exact Mass | 292.13600 |
| PSA | 85.18000 |
| LogP | 2.77430 |
| Index of Refraction | 1.627 |
| InChIKey | FFTZKNUCZBNPLP-ASPATJOSSA-N |
| SMILES | CC(N=NC(=S)N1CCCC(C)C1)=C1C=CC=CN1O |
|
~96%
N-[1-(1-hydroxy... CAS#:87587-06-2 |
| Literature: Scovill, John P.; Klayman, Daniel L.; Lambros, Chris; Childs, George E.; Notsch, John D. Journal of Medicinal Chemistry, 1984 , vol. 27, # 1 p. 87 - 91 |
|
~%
N-[1-(1-hydroxy... CAS#:87587-06-2 |
| Literature: Scovill, John P.; Klayman, Daniel L.; Lambros, Chris; Childs, George E.; Notsch, John D. Journal of Medicinal Chemistry, 1984 , vol. 27, # 1 p. 87 - 91 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |