Dehydromarmeline
Modify Date: 2026-07-06 21:51:28
Dehydromarmeline structure
|
Common Name | Dehydromarmeline | ||
|---|---|---|---|---|
| CAS Number | 87596-51-8 | Molecular Weight | 335.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dehydromarmeline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H25NO2 |
|---|---|
| Molecular Weight | 335.4 |
| InChIKey | GDBYZGRXGDJMHH-JLHYYAGUSA-N |
| SMILES | CC(C)=CCOc1ccc(CCNC(=O)C=Cc2ccccc2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 11, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Dehydromarmeline? |
| A: The English name of Dehydromarmeline is Dehydromarmeline. |
| Q: What is the SMILES notation of Dehydromarmeline? |
| A: SMILES notation of Dehydromarmeline is CC(C)=CCOc1ccc(CCNC(=O)C=Cc2ccccc2)cc1. |
| Q: What is the Chinese name of 87596-51-8? |
| A: Chinese name of 87596-51-8 is 87596-51-8. |
| Q: What is the InChIKey of Dehydromarmeline? |
| A: InChIKey of Dehydromarmeline is GDBYZGRXGDJMHH-JLHYYAGUSA-N. |
| Q: What is the CAS number of Dehydromarmeline? |
| A: CAS number of Dehydromarmeline is 87596-51-8. |
| Q: What is the molecular weight of Dehydromarmeline? |
| A: Molecular weight of Dehydromarmeline is 335.4. |
| Q: What is the molecular formula of Dehydromarmeline? |
| A: Molecular formula of Dehydromarmeline is C22H25NO2. |