N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide
N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide structure
|
Common Name | N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 876-96-0 | Molecular Weight | 169.13800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H7N3O3 |
|---|---|
| Molecular Weight | 169.13800 |
| Exact Mass | 169.04900 |
| PSA | 98.83000 |
| InChIKey | XCXOWNJENHBRDI-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1c[nH]c(=O)[nH]c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-methyl-2,4-di... CAS#:876-96-0 |
| Literature: Miyashita; Matsumura; Kasahara; Shimadzu; Hashimoto Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 3 p. 887 - 898 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| uracil-5-(N-methyl)carboxamid |
| 2,6-Dihydroxy-pyrimidin-5-carbonsaeure-methyl-amid |
| 2,4-dioxo-1,2,3,4-tetrahydro-pyrimidine-5-carboxylic acid methylamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: Molecular formula of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is C6H7N3O3. |
| Q: What is the InChIKey of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: InChIKey of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is XCXOWNJENHBRDI-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: CAS number of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is 876-96-0. |
| Q: What is the English name of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: The English name of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide. |
| Q: What is the polar surface area (PSA) of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: Polar surface area (PSA) of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is 98.83000. |
| Q: What English synonyms does N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide have? |
| A: English synonyms of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide: uracil-5-(N-methyl)carboxamid, 2,6-Dihydroxy-pyrimidin-5-carbonsaeure-methyl-amid, 2,4-dioxo-1,2,3,4-tetrahydro-pyrimidine-5-carboxylic acid methylamide. |
| Q: What is the SMILES notation of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: SMILES notation of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is CNC(=O)c1c[nH]c(=O)[nH]c1=O. |
| Q: What are the upstream materials of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: Related upstream materials(CAS) of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide: 42821-92-1;74-89-5. |
| Q: What is the molecular weight of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide? |
| A: Molecular weight of N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is 169.13800. |
| Q: What is the Chinese name of 876-96-0? |
| A: Chinese name of 876-96-0 is 876-96-0. |