N-(4-(4-Phenyl-1-piperazinyl)phenyl)-2,6,8-trimethyl-4-quinolinamine structure
|
Common Name | N-(4-(4-Phenyl-1-piperazinyl)phenyl)-2,6,8-trimethyl-4-quinolinamine | ||
|---|---|---|---|---|
| CAS Number | 87602-41-3 | Molecular Weight | 422.56500 | |
| Density | 1.176g/cm3 | Boiling Point | 610.2ºC at 760 mmHg | |
| Molecular Formula | C28H30N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 610.2ºC at 760 mmHg |
| Molecular Formula | C28H30N4 |
| Molecular Weight | 422.56500 |
| Flash Point | 322.9ºC |
| Exact Mass | 422.24700 |
| PSA | 34.63000 |
| LogP | 5.78210 |
| Index of Refraction | 1.67 |
| InChIKey | RGHHKTSAQKTSMJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2nc(C)cc(Nc3ccc(N4CCN(c5ccccc5)CC4)cc3)c2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
N-(4-(4-Phenyl-... CAS#:87602-41-3 |
| Literature: Sathi; Gujrati; Sharma; Nath; Bhargava; Shanker Archiv der Pharmazie, 1983 , vol. 316, # 9 p. 767 - 772 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Quinolinamine,N-(4-(4-phenyl-1-piperazinyl)phenyl)-2,6,8-trimethyl |
| N-(4-(4-Phenyl-1-piperazinyl)phenyl)-2,6,8-trimethyl-4-quinolinamine |
| 4-Quinolinamine,2,6,8-trimethyl-N-[4-(4-phenyl-1-piperazinyl)phenyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: Polar surface area (PSA) of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine is 34.63000. |
| Q: What is the SMILES notation of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: SMILES notation of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine is Cc1cc(C)c2nc(C)cc(Nc3ccc(N4CCN(c5ccccc5)CC4)cc3)c2c1. |
| Q: What is the English name of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: The English name of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine is 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine. |
| Q: What English synonyms does 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine have? |
| A: English synonyms of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine: 4-Quinolinamine,N-(4-(4-phenyl-1-piperazinyl)phenyl)-2,6,8-trimethyl, N-(4-(4-Phenyl-1-piperazinyl)phenyl)-2,6,8-trimethyl-4-quinolinamine, 4-Quinolinamine,2,6,8-trimethyl-N-[4-(4-phenyl-1-piperazinyl)phenyl]. |
| Q: What is the molecular formula of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: Molecular formula of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine is C28H30N4. |
| Q: What is the InChIKey of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: InChIKey of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine is RGHHKTSAQKTSMJ-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: LogP of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine is 5.78210. |
| Q: What are the upstream materials of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: Related upstream materials(CAS) of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine: 87602-66-2;68944-97-8. |
| Q: What is the Chinese name of 87602-41-3? |
| A: Chinese name of 87602-41-3 is 87602-41-3. |
| Q: What is the CAS number of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine? |
| A: CAS number of 2,6,8-trimethyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]quinolin-4-amine is 87602-41-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |