1-chloro-2,6-diphenylpiperidin-4-one structure
|
Common Name | 1-chloro-2,6-diphenylpiperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 87621-18-9 | Molecular Weight | 285.76800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-2,6-diphenylpiperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16ClNO |
|---|---|
| Molecular Weight | 285.76800 |
| Exact Mass | 285.09200 |
| PSA | 20.31000 |
| LogP | 4.22560 |
| InChIKey | HXUGUSZGAVOXCO-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)N(Cl)C(c2ccccc2)C1 |
|
~%
1-chloro-2,6-di... CAS#:87621-18-9 |
| Literature: Ganapathy, K.; Vijayan, B. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 572 - 574 |
|
~%
1-chloro-2,6-di... CAS#:87621-18-9 |
| Literature: Hasan, Misbah Ul; Arab, M. Magnetic Resonance in Chemistry, 1987 , vol. 25, p. 987 - 989 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-chloro-2,6-diphenylpiperidin-4-one |
| 4-Piperidinone,1-chloro-2,6-diphenyl |