6-methylflavone-8-acetic acid structure
|
Common Name | 6-methylflavone-8-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 87626-74-2 | Molecular Weight | 294.30100 | |
| Density | 1.319g/cm3 | Boiling Point | 528.8ºC at 760 mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 2-(6-methyl-4-oxo-2-phenylchromen-8-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 528.8ºC at 760 mmHg |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30100 |
| Flash Point | 197.9ºC |
| Exact Mass | 294.08900 |
| PSA | 67.51000 |
| LogP | 3.39550 |
| Index of Refraction | 1.638 |
| InChIKey | PXDPYVSPUBJYGI-UHFFFAOYSA-N |
| SMILES | Cc1cc(CC(=O)O)c2oc(-c3ccccc3)cc(=O)c2c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-acetic acid |
| 6-Methylflavone-8-acetate |
| 6-Methylflavone-8-acetic acid |
| 6-Me-Flavone-8-acetate |
| 8-carboxymethyl-6-methyl-2-phenyl-4H-1-benzopyran-4-one |