2-(2-naphthalen-2-yl-4-oxo-chromen-8-yl)acetic acid structure
|
Common Name | 2-(2-naphthalen-2-yl-4-oxo-chromen-8-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 87627-08-5 | Molecular Weight | 330.33300 | |
| Density | 1.371g/cm3 | Boiling Point | 589.6ºC at 760 mmHg | |
| Molecular Formula | C21H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.8ºC | |
| Name | 2-(2-naphthalen-2-yl-4-oxochromen-8-yl)acetic acid |
|---|
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 589.6ºC at 760 mmHg |
| Molecular Formula | C21H14O4 |
| Molecular Weight | 330.33300 |
| Flash Point | 216.8ºC |
| Exact Mass | 330.08900 |
| PSA | 67.51000 |
| LogP | 4.24030 |
| Index of Refraction | 1.7 |
| InChIKey | QTEYJXQDEBFAGS-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc2c(=O)cc(-c3ccc4ccccc4c3)oc12 |
|
~62%
2-(2-naphthalen... CAS#:87627-08-5 |
| Literature: Atassi; Briet; Berthelon; Collonges European Journal of Medicinal Chemistry, 1985 , vol. 20, # 5 p. 393 - 402 |
|
~%
2-(2-naphthalen... CAS#:87627-08-5 |
| Literature: Atassi; Briet; Berthelon; Collonges European Journal of Medicinal Chemistry, 1985 , vol. 20, # 5 p. 393 - 402 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |