2-(4-oxo-2,3-diphenyl-chromen-8-yl)acetic acid structure
|
Common Name | 2-(4-oxo-2,3-diphenyl-chromen-8-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 87627-20-1 | Molecular Weight | 356.37100 | |
| Density | 1.325g/cm3 | Boiling Point | 583.5ºC at 760 mmHg | |
| Molecular Formula | C23H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 2-(4-oxo-2,3-diphenylchromen-8-yl)acetic acid |
|---|
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 583.5ºC at 760 mmHg |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.37100 |
| Flash Point | 208.9ºC |
| Exact Mass | 356.10500 |
| PSA | 67.51000 |
| LogP | 4.75410 |
| Index of Refraction | 1.664 |
| InChIKey | BWJOQFQALICWAJ-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc2c(=O)c(-c3ccccc3)c(-c3ccccc3)oc12 |
|
~%
2-(4-oxo-2,3-di... CAS#:87627-20-1 |
| Literature: Atassi; Briet; Berthelon; Collonges European Journal of Medicinal Chemistry, 1985 , vol. 20, # 5 p. 393 - 402 |
|
~31%
2-(4-oxo-2,3-di... CAS#:87627-20-1 |
| Literature: Atassi; Briet; Berthelon; Collonges European Journal of Medicinal Chemistry, 1985 , vol. 20, # 5 p. 393 - 402 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |