propan-2-yl 2-[amino(ethylsulfanyl)phosphoryl]oxybenzoate structure
|
Common Name | propan-2-yl 2-[amino(ethylsulfanyl)phosphoryl]oxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 87647-72-1 | Molecular Weight | 303.31400 | |
| Density | 1.248g/cm3 | Boiling Point | 429.1ºC at 760 mmHg | |
| Molecular Formula | C12H18NO4PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.3ºC | |
| Name | propan-2-yl 2-[amino(ethylsulfanyl)phosphoryl]oxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760 mmHg |
| Molecular Formula | C12H18NO4PS |
| Molecular Weight | 303.31400 |
| Flash Point | 213.3ºC |
| Exact Mass | 303.06900 |
| PSA | 113.73000 |
| LogP | 4.15080 |
| Index of Refraction | 1.546 |
| InChIKey | CRYKIKXWXSSEGR-UHFFFAOYSA-N |
| SMILES | CCSP(N)(=O)Oc1ccccc1C(=O)OC(C)C |
| Benzoic acid,2-((amino(ethylthio)phosphinyl)oxy)-,1-methylethyl ester |
| Salicylic acid,isopropyl ester,ester with S-ethyl phosphoramidothioate |