2-iodo-1-nitro-3-phenylbenzene structure
|
Common Name | 2-iodo-1-nitro-3-phenylbenzene | ||
|---|---|---|---|---|
| CAS Number | 87666-87-3 | Molecular Weight | 325.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-1-nitro-3-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8INO2 |
|---|---|
| Molecular Weight | 325.10200 |
| Exact Mass | 324.96000 |
| PSA | 45.82000 |
| LogP | 4.38960 |
| InChIKey | DRXIHRCXPXDZHA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2ccccc2)c1I |
|
~%
2-iodo-1-nitro-... CAS#:87666-87-3 |
| Literature: Sako Bulletin of the Chemical Society of Japan, 1934 , vol. 9, p. 55,69 |
|
~%
2-iodo-1-nitro-... CAS#:87666-87-3 |
| Literature: Ozasa, Shigeru; Fujioka, Yasuhiro; Kikutake, Jun-ichiro; Ibuki, Eiichi Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 5 p. 1572 - 1581 |
| 2-iodo-3-nitro-biphenyl |
| 2-Jod-3-nitro-biphenyl |
| 1,1'-Biphenyl,2-iodo-3-nitro |