2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile
Modify Date: 2026-07-04 16:21:53
![2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile Structure](https://www.chemsrc.com/extcaspic/497/876746-72-4.png)
2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile structure
|
Common Name | 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 876746-72-4 | Molecular Weight | 334.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H18N2O3 |
|---|---|
| Molecular Weight | 334.4 |
| InChIKey | YJQRAUKHTVMFCG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CC(=O)c2ccccc2)C(C#N)C#N)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile? |
| A: The English name of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile is 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile. |
| Q: What is the molecular formula of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile? |
| A: Molecular formula of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile is C20H18N2O3. |
| Q: What is the InChIKey of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile? |
| A: InChIKey of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile is YJQRAUKHTVMFCG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile? |
| A: Molecular weight of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile is 334.4. |
| Q: What is the CAS number of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile? |
| A: CAS number of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile is 876746-72-4. |
| Q: What is the Chinese name of 876746-72-4? |
| A: Chinese name of 876746-72-4 is 876746-72-4. |
| Q: What is the SMILES notation of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile? |
| A: SMILES notation of 2-[1-(3,4-Dimethoxyphenyl)-3-oxo-3-phenylpropyl]propanedinitrile is COc1ccc(C(CC(=O)c2ccccc2)C(C#N)C#N)cc1OC. |