2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one
2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one structure
|
Common Name | 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one | ||
|---|---|---|---|---|
| CAS Number | 87698-48-4 | Molecular Weight | 224.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20O3 |
|---|---|
| Molecular Weight | 224.29600 |
| Exact Mass | 224.14100 |
| PSA | 35.53000 |
| LogP | 2.80260 |
| InChIKey | WJNFIGUWSXRYFH-UHFFFAOYSA-N |
| SMILES | CCOC1CCC2=C(CC(C)(C)CC2=O)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~55%
2-ethoxy-7,7-di... CAS#:87698-48-4 |
| Literature: Coates, Robert M.; Hobbs, Steven J. Journal of Organic Chemistry, 1984 , vol. 49, p. 140 - 152 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-ethoxy-7,7-dimethyl-3,4,7,8-tetrahydro-2H-benzo<b>pyran-5(6H)-one |
| 2-Ethoxy-3,4,6,7,8,9-hexahydro-7,7-dimethyl-5-oxo-2H-chromene |
| 5H-1-Benzopyran-5-one,2-ethoxy-2,3,4,6,7,8-hexahydro-7,7-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: Molecular formula of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one is C13H20O3. |
| Q: What is the molecular weight of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: Molecular weight of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one is 224.29600. |
| Q: What is the polar surface area (PSA) of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: Polar surface area (PSA) of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one is 35.53000. |
| Q: What English synonyms does 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one have? |
| A: English synonyms of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one: 2-ethoxy-7,7-dimethyl-3,4,7,8-tetrahydro-2H-benzopyran-5(6H)-one, 2-Ethoxy-3,4,6,7,8,9-hexahydro-7,7-dimethyl-5-oxo-2H-chromene, 5H-1-Benzopyran-5-one,2-ethoxy-2,3,4,6,7,8-hexahydro-7,7-dimethyl. |
| Q: What is the English name of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: The English name of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one is 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one. |
| Q: What is the SMILES notation of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: SMILES notation of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one is CCOC1CCC2=C(CC(C)(C)CC2=O)O1. |
| Q: What is the CAS number of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: CAS number of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one is 87698-48-4. |
| Q: What is the Chinese name of 87698-48-4? |
| A: Chinese name of 87698-48-4 is 87698-48-4. |
| Q: What is the InChIKey of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: InChIKey of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one is WJNFIGUWSXRYFH-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one? |
| A: Related upstream materials(CAS) of 2-ethoxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one: 3054-95-3;126-81-8. |