1,3,5-Triazine-2,4-diamine,1,6-dihydro-6,6-dimethyl-1-(4-propoxyphenyl)-, hydrochloride (1:1) structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,1,6-dihydro-6,6-dimethyl-1-(4-propoxyphenyl)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 87739-50-2 | Molecular Weight | 311.81000 | |
| Density | 1.22g/cm3 | Boiling Point | 433.7ºC at 760mmHg | |
| Molecular Formula | C14H22ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.1ºC | |
| Name | 6,6-dimethyl-1-(4-propoxyphenyl)-1,3,5-triazine-2,4-diamine,hydrochloride |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 433.7ºC at 760mmHg |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.81000 |
| Flash Point | 216.1ºC |
| Exact Mass | 311.15100 |
| PSA | 89.23000 |
| LogP | 2.79970 |
| Index of Refraction | 1.605 |
| InChIKey | WEAPRDKITPIYME-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(N2C(N)=NC(N)=NC2(C)C)cc1.Cl |
|
~69%
1,3,5-Triazine-... CAS#:87739-50-2 |
| Literature: Hansch; Hathaway; Guo; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 129 - 143 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |