4-[(4-nitrophenoxy)methyl]benzoic acid structure
|
Common Name | 4-[(4-nitrophenoxy)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 87740-05-4 | Molecular Weight | 273.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-nitrophenoxy)methyl]benzoic acid |
|---|
| Molecular Formula | C14H11NO5 |
|---|---|
| Molecular Weight | 273.24100 |
| Exact Mass | 273.06400 |
| PSA | 92.35000 |
| LogP | 3.39520 |
| InChIKey | OJGWJMNQVVFIIN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(COc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~72%
4-[(4-nitrophen... CAS#:87740-05-4 |
| Literature: Hansch; Hathaway; Guo; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 129 - 143 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |