4-[(3-nitrophenoxy)methyl]benzamide structure
|
Common Name | 4-[(3-nitrophenoxy)methyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 87740-08-7 | Molecular Weight | 272.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(3-nitrophenoxy)methyl]benzamide |
|---|
| Molecular Formula | C14H12N2O4 |
|---|---|
| Molecular Weight | 272.25600 |
| Exact Mass | 272.08000 |
| PSA | 98.14000 |
| LogP | 3.49620 |
| InChIKey | SMLAVQLKCSJIIJ-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(COc2cccc([N+](=O)[O-])c2)cc1 |
|
~%
4-[(3-nitrophen... CAS#:87740-08-7 |
| Literature: Hansch; Hathaway; Guo; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 129 - 143 |
|
~%
4-[(3-nitrophen... CAS#:87740-08-7 |
| Literature: Hansch; Hathaway; Guo; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 129 - 143 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |