N-[2,3-dichloro-4-(4-methoxybenzoyl)phenyl]-2-hydroxyacetamide structure
|
Common Name | N-[2,3-dichloro-4-(4-methoxybenzoyl)phenyl]-2-hydroxyacetamide | ||
|---|---|---|---|---|
| CAS Number | 87762-08-1 | Molecular Weight | 354.18500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2,3-dichloro-4-(4-methoxybenzoyl)phenyl]-2-hydroxyacetamide |
|---|
| Molecular Formula | C16H13Cl2NO4 |
|---|---|
| Molecular Weight | 354.18500 |
| Exact Mass | 353.02200 |
| PSA | 79.12000 |
| LogP | 3.81330 |
| InChIKey | QREUBAOMBMJGFD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(NC(=O)CO)c(Cl)c2Cl)cc1 |
|
~49%
N-[2,3-dichloro... CAS#:87762-08-1 |
| Literature: Baker, William R. Journal of Organic Chemistry, 1983 , vol. 48, # 25 p. 5140 - 5143 |
|
~%
N-[2,3-dichloro... CAS#:87762-08-1 |
| Literature: Baker, William R. Journal of Organic Chemistry, 1983 , vol. 48, # 25 p. 5140 - 5143 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |