Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate
Modify Date: 2025-08-31 17:34:57
![Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate Structure](https://www.chemsrc.com/extcaspic/146/877623-73-9.png)
Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate structure
|
Common Name | Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate | ||
|---|---|---|---|---|
| CAS Number | 877623-73-9 | Molecular Weight | 418.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H23ClN2O3S |
|---|---|
| Molecular Weight | 418.9 |
| InChIKey | BAKNKEOGYPMIDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Cn1c(SCCOc2ccc(Cl)cc2)nc2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate? |
| A: CAS number of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate is 877623-73-9. |
| Q: What is the molecular formula of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate? |
| A: Molecular formula of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate is C21H23ClN2O3S. |
| Q: What is the English name of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate? |
| A: The English name of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate is Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate. |
| Q: What is the molecular weight of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate? |
| A: Molecular weight of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate is 418.9. |
| Q: What is the SMILES notation of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate? |
| A: SMILES notation of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate is CC(C)(C)OC(=O)Cn1c(SCCOc2ccc(Cl)cc2)nc2ccccc21. |
| Q: What is the InChIKey of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate? |
| A: InChIKey of Tert-butyl{2-[2-(4-chloro-phenoxy)-ethylsulfanyl]-benzoimidazol-1-yl}-acetate is BAKNKEOGYPMIDE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 877623-73-9? |
| A: Chinese name of 877623-73-9 is 877623-73-9. |