6-(((5-(2-ethylbutanamido)-1,3,4-thiadiazol-2-yl)thio)methyl)-4-oxo-4H-pyran-3-yl 5-chloro-2-nitrobenzoate
Modify Date: 2025-09-14 06:50:27
6-(((5-(2-ethylbutanamido)-1,3,4-thiadiazol-2-yl)thio)methyl)-4-oxo-4H-pyran-3-yl 5-chloro-2-nitrobenzoate structure
|
Common Name | 6-(((5-(2-ethylbutanamido)-1,3,4-thiadiazol-2-yl)thio)methyl)-4-oxo-4H-pyran-3-yl 5-chloro-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 877652-16-9 | Molecular Weight | 539.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19ClN4O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(((5-(2-ethylbutanamido)-1,3,4-thiadiazol-2-yl)thio)methyl)-4-oxo-4H-pyran-3-yl 5-chloro-2-nitrobenzoate |
|---|
| Molecular Formula | C21H19ClN4O7S2 |
|---|---|
| Molecular Weight | 539.0 |
| InChIKey | PXXTZPWONHKLQQ-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(=O)Nc1nnc(SCc2cc(=O)c(OC(=O)c3cc(Cl)ccc3[N+](=O)[O-])co2)s1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1