5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol
Modify Date: 2026-06-19 18:02:05
![5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol Structure](https://www.chemsrc.com/extcaspic/325/877800-82-3.png)
5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol structure
|
Common Name | 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol | ||
|---|---|---|---|---|
| CAS Number | 877800-82-3 | Molecular Weight | 315.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18ClN3O |
|---|---|
| Molecular Weight | 315.8 |
| InChIKey | OEGCIQAKZFWEQC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=CC(=O)N2N1)C(C)(C)C)C3=CC=C(C=C3)Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: SMILES notation of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol is CC1=C(C2=NC(=CC(=O)N2N1)C(C)(C)C)C3=CC=C(C=C3)Cl. |
| Q: What is the English name of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: The English name of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol is 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol. |
| Q: What is the molecular formula of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: Molecular formula of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol is C17H18ClN3O. |
| Q: What is the CAS number of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: CAS number of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol is 877800-82-3. |
| Q: What is the InChIKey of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: InChIKey of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol is OEGCIQAKZFWEQC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 877800-82-3? |
| A: Chinese name of 877800-82-3 is 877800-82-3. |
| Q: What is the molecular weight of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: Molecular weight of 5-(Tert-butyl)-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-ol is 315.8. |