3-[2-(1,3-dioxan-2-yl)-2-methylpropyl]cyclopent-2-en-1-one structure
|
Common Name | 3-[2-(1,3-dioxan-2-yl)-2-methylpropyl]cyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 87802-32-2 | Molecular Weight | 224.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2-(1,3-dioxan-2-yl)-2-methylpropyl]cyclopent-2-en-1-one |
|---|
| Molecular Formula | C13H20O3 |
|---|---|
| Molecular Weight | 224.29600 |
| Exact Mass | 224.14100 |
| PSA | 35.53000 |
| LogP | 2.45500 |
| InChIKey | FHJRXBQLFZKXHO-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=O)CC1)C1OCCCO1 |
|
~%
3-[2-(1,3-dioxa... CAS#:87802-32-2 |
| Literature: Paquette,L.A.; Leone-Bay,A. Journal of the American Chemical Society, 1983 , vol. 105, p. 7352 |
|
~%
3-[2-(1,3-dioxa... CAS#:87802-32-2 |
| Literature: Paquette,L.A.; Leone-Bay,A. Journal of the American Chemical Society, 1983 , vol. 105, p. 7352 |
|
~%
3-[2-(1,3-dioxa... CAS#:87802-32-2 |
| Literature: Paquette,L.A.; Leone-Bay,A. Journal of the American Chemical Society, 1983 , vol. 105, p. 7352 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |