methyl 2-(benzenesulfonyl)-5-phenylpent-4-enoate structure
|
Common Name | methyl 2-(benzenesulfonyl)-5-phenylpent-4-enoate | ||
|---|---|---|---|---|
| CAS Number | 87802-82-2 | Molecular Weight | 330.39800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(benzenesulfonyl)-5-phenylpent-4-enoate |
|---|
| Molecular Formula | C18H18O4S |
|---|---|
| Molecular Weight | 330.39800 |
| Exact Mass | 330.09300 |
| PSA | 68.82000 |
| LogP | 4.18620 |
| InChIKey | WWDXAVNLFSVTDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC=Cc1ccccc1)S(=O)(=O)c1ccccc1 |
|
~28%
methyl 2-(benze... CAS#:87802-82-2
Detail
|
| Literature: Trost, Barry M.; Hung, Ming-Hong Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7757 - 7759 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |