1,1-bis(benzenesulfonyl)but-3-en-2-ylbenzene structure
|
Common Name | 1,1-bis(benzenesulfonyl)but-3-en-2-ylbenzene | ||
|---|---|---|---|---|
| CAS Number | 87802-83-3 | Molecular Weight | 412.52200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-bis(benzenesulfonyl)but-3-en-2-ylbenzene |
|---|
| Molecular Formula | C22H20O4S2 |
|---|---|
| Molecular Weight | 412.52200 |
| Exact Mass | 412.08000 |
| PSA | 85.04000 |
| LogP | 6.39170 |
| InChIKey | GUBRMLBRLAFDHG-UHFFFAOYSA-N |
| SMILES | C=CC(c1ccccc1)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
|
~51%
1,1-bis(benzene... CAS#:87802-83-3 |
| Literature: Trost, Barry M.; Hung, Ming-Hong Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7757 - 7759 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |