dimethyl 2-(1-pyridin-2-ylprop-2-enyl)propanedioate structure
|
Common Name | dimethyl 2-(1-pyridin-2-ylprop-2-enyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 87802-92-4 | Molecular Weight | 249.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-(1-pyridin-2-ylprop-2-enyl)propanedioate |
|---|
| Molecular Formula | C13H15NO4 |
|---|---|
| Molecular Weight | 249.26200 |
| Exact Mass | 249.10000 |
| PSA | 65.49000 |
| LogP | 1.31340 |
| InChIKey | QUHGRRDGPKZFNE-UHFFFAOYSA-N |
| SMILES | C=CC(c1ccccn1)C(C(=O)OC)C(=O)OC |
|
~%
dimethyl 2-(1-p... CAS#:87802-92-4 |
| Literature: Trost, Barry M.; Hung, Ming-Hong Journal of the American Chemical Society, 1984 , vol. 106, # 22 p. 6837 - 6839 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |