4-[(4-Acetyl-3-hydroxy-2-propylphenoxy)methyl]benzoic acid
Modify Date: 2025-11-05 10:36:26
![4-[(4-Acetyl-3-hydroxy-2-propylphenoxy)methyl]benzoic acid Structure](https://www.chemsrc.com/extcaspic/308/87807-96-3.png)
4-[(4-Acetyl-3-hydroxy-2-propylphenoxy)methyl]benzoic acid structure
|
Common Name | 4-[(4-Acetyl-3-hydroxy-2-propylphenoxy)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 87807-96-3 | Molecular Weight | 328.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-Acetyl-3-hydroxy-2-propylphenoxy)methyl]benzoic acid |
|---|
| Molecular Formula | C19H20O5 |
|---|---|
| Molecular Weight | 328.4 |
| InChIKey | AJEIZQFXOOTMAN-UHFFFAOYSA-N |
| SMILES | CCCc1c(OCc2ccc(C(=O)O)cc2)ccc(C(C)=O)c1O |
|
Name: Percent inhibition of the leukotriene D4 (LTD4)-induced contraction of guinea pig tra...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL692858
|
|
Name: ASTRAZENECA: Octan-1-ol/water (pH7.4) distribution coefficent measured by a shake fl...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3301363
|
|
Name: Inhibition of the leukotriene D4 (LTD4)-induced contraction of guinea pig tracheal sp...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL692849
|
Total 3, Current Page 1 of 1
1