N-benzyl-N-(trimethylsilylmethyl)aminoacetonitrile structure
|
Common Name | N-benzyl-N-(trimethylsilylmethyl)aminoacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 87813-07-8 | Molecular Weight | 232.39700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-N-(cyanomethyl)-N-[(trimethylsilyl)methyl]amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20N2Si |
|---|---|
| Molecular Weight | 232.39700 |
| Exact Mass | 232.14000 |
| PSA | 27.03000 |
| LogP | 3.30788 |
| InChIKey | MIAHSUODJNPFGX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CN(CC#N)Cc1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~%
N-benzyl-N-(tri... CAS#:87813-07-8 |
| Literature: Padwa, Albert; Chen, Yon-Yih; Dent, William; Nimmesgern, Hildegard Journal of Organic Chemistry, 1985 , vol. 50, # 21 p. 4006 - 4014 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (N-Benzyl-N-trimethylsilanylmethyl-amino)acetonitrile |
| N-BENZYL-N-(TRIMETHYLSILYLMETHYL)AMINOACETONITRILE |
| N-benzyl-N-cyanomethyl-N-trimethylsilylmethylamine |
| [benzyl(trimethylsilylmethyl)amino]acetonitrile |
| n-butyl methylphosphonite |