2-(Methoxycarbonyl)-3-Methylpyridine 1-oxide structure
|
Common Name | 2-(Methoxycarbonyl)-3-Methylpyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 878207-91-1 | Molecular Weight | 167.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-methyl-2-pyridinecarboxylate 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9NO3 |
|---|---|
| Molecular Weight | 167.16200 |
| Exact Mass | 167.05800 |
| PSA | 51.76000 |
| LogP | 1.21010 |
| InChIKey | YSRBMUMDFAGAAD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)ccc[n+]1[O-] |
| HS Code | 2933399090 |
|---|
|
~98%
2-(Methoxycarbo... CAS#:878207-91-1 |
| Literature: Lim, Chae Jo; Kim, Ji Young; Lee, Byung Ho; Oh, Kwang-Seok; Yi, Kyu Yang Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 6 p. 1736 - 1739 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 3-hydroxy-5-methyl-2-thiophenecarboxylate |
| 2-methoxycarbonyl-3-hydroxy-5-methyl-thiophene |
| 3-Hydroxy-5-methyl-2-thiophenecarboxylic acid methyl ester |
| 3-methyl-2-pyridinecarboxylic acid 1-oxide methyl ester |
| 3-Hydroxy-5-methyl-thiophen-2-carbonsaeure-methylester |
| 2-Thiophenecarboxylic acid,3-hydroxy-5-methyl-,methyl ester |
| 3-hydroxy-5-methylthiophene-2-carboxylic acid methyl ester |