4-[3-(3-carboxypropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid structure
|
Common Name | 4-[3-(3-carboxypropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 87826-99-1 | Molecular Weight | 476.64500 | |
| Density | 1.16g/cm3 | Boiling Point | 619.9ºC at 760 mmHg | |
| Molecular Formula | C28H44O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | 4-[3-(3-carboxypropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 619.9ºC at 760 mmHg |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.64500 |
| Flash Point | 198.5ºC |
| Exact Mass | 476.31400 |
| PSA | 100.90000 |
| LogP | 5.92280 |
| Index of Refraction | 1.542 |
| InChIKey | DFOFHELKYLKULT-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4CC(OC(=O)CCC(=O)O)CCC4(C)C3CCC12C |
|
~42%
4-[3-(3-carboxy... CAS#:87826-99-1 |
| Literature: Dang, Zhao; Lin, Andrew; Ho, Phong; Soroka, Dominique; Lee, Kuo-Hsiung; Huang, Li; Chen, Chin-Ho Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 7 p. 1926 - 1928 |
|
~86%
4-[3-(3-carboxy... CAS#:87826-99-1 |
| Literature: Li, Zi-Chen; Li, Fu-Mian; Arase, Shinya; Takeoka, shinji; Tsuchide, Eishun Chemistry Letters, 1994 , # 12 p. 2199 - 2202 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |