Isoxapyrifop, (R)
Modify Date: 2026-07-04 21:27:32
Isoxapyrifop, (R) structure
|
Common Name | Isoxapyrifop, (R) | ||
|---|---|---|---|---|
| CAS Number | 87828-17-9 | Molecular Weight | 383.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isoxapyrifop, (R) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16Cl2N2O4 |
|---|---|
| Molecular Weight | 383.2 |
| InChIKey | ANFHKXSOSRDDRQ-LLVKDONJSA-N |
| SMILES | CC(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)N1CCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Isoxapyrifop, (R)? |
| A: Molecular weight of Isoxapyrifop, (R) is 383.2. |
| Q: What is the Chinese name of 87828-17-9? |
| A: Chinese name of 87828-17-9 is 87828-17-9. |
| Q: What is the molecular formula of Isoxapyrifop, (R)? |
| A: Molecular formula of Isoxapyrifop, (R) is C17H16Cl2N2O4. |
| Q: What is the CAS number of Isoxapyrifop, (R)? |
| A: CAS number of Isoxapyrifop, (R) is 87828-17-9. |
| Q: What is the InChIKey of Isoxapyrifop, (R)? |
| A: InChIKey of Isoxapyrifop, (R) is ANFHKXSOSRDDRQ-LLVKDONJSA-N. |
| Q: What is the SMILES notation of Isoxapyrifop, (R)? |
| A: SMILES notation of Isoxapyrifop, (R) is CC(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)N1CCCO1. |
| Q: What is the English name of Isoxapyrifop, (R)? |
| A: The English name of Isoxapyrifop, (R) is Isoxapyrifop, (R). |