3-hydroxy-3-(2-hydroxyphenyl)-1-phenylpropan-1-one structure
|
Common Name | 3-hydroxy-3-(2-hydroxyphenyl)-1-phenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 87831-13-8 | Molecular Weight | 242.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-3-(2-hydroxyphenyl)-1-phenylpropan-1-one |
|---|
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.27000 |
| Exact Mass | 242.09400 |
| PSA | 57.53000 |
| LogP | 2.69860 |
| InChIKey | QMNCSZAATSCKSO-UHFFFAOYSA-N |
| SMILES | O=C(CC(O)c1ccccc1O)c1ccccc1 |
|
~%
3-hydroxy-3-(2-... CAS#:87831-13-8 |
| Literature: Mashraqui, Sabir H.; Kellogg, Richard M. Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7792 - 7793 |
|
~%
3-hydroxy-3-(2-... CAS#:87831-13-8 |
| Literature: Rangnekar, D.W.,; Dhamnaskar, S.V., Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 1767 - 1768 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |