2-trimethylsilylethyl 2-azido-4-bromobutanoate structure
|
Common Name | 2-trimethylsilylethyl 2-azido-4-bromobutanoate | ||
|---|---|---|---|---|
| CAS Number | 87831-16-1 | Molecular Weight | 308.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18BrN3O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-trimethylsilylethyl 2-azido-4-bromobutanoate |
|---|
| Molecular Formula | C9H18BrN3O2Si |
|---|---|
| Molecular Weight | 308.24800 |
| Exact Mass | 307.03500 |
| PSA | 76.05000 |
| LogP | 2.78446 |
| InChIKey | WIZURMAGOVWDNZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOC(=O)C(CCBr)N=[N+]=[N-] |
|
~%
2-trimethylsily... CAS#:87831-16-1 |
| Literature: Pirrung, Michael C.; McGeehan, Gerard M. Journal of Organic Chemistry, 1983 , vol. 48, # 25 p. 5143 - 5144 |
|
~%
2-trimethylsily... CAS#:87831-16-1 |
| Literature: Pirrung, Michael C.; McGeehan, Gerard M. Journal of Organic Chemistry, 1983 , vol. 48, # 25 p. 5143 - 5144 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |